4-isocyanato-2-(trifluoromethyl)benzonitrile

4-isocyanato-2-(trifluoromethyl)benzonitrile

2-fluoro-N-methyl-4-nitrobenzamide

2-fluoro-N-methyl-4-nitrobenzamide

1-(4-fluorophenyl)-2-phenylethan-1-one

$365.00
CAS No.: 347-84-2
Catalog No.: 194261
Purity: 95%
MF: C14H11FO
MW: 214.239
Storage: 2-8 degree Celsius
SMILES: FC1=CC=C(C=C1)C(CC1=CC=CC=C1)=O
Availability:
In stock
SKU
194261
  • Size
    Price
    Stock
    Estimated Shipping Time
1-(4-fluorophenyl)-2-phenylethan-1-one; CAS No.: 347-84-2; 1-(4-fluorophenyl)-2-phenylethan-1-one. PROPERTIES: 1-(4-fluorophenyl)-2-phenylethan-1-one is a crystalline solid. Its molecular formula is C14H11FO, and the molecular weight is approximately 210.24 g/mol. The compound has a melting point of approximately 60-62 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a ketone group and two phenyl groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 1-(4-fluorophenyl)-2-phenylethan-1-one serves as a valuable intermediate. The ketone group can undergo various reactions such as nucleophilic addition, reduction, and condensation. The fluoro group provides specific electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of 1-(4-fluorophenyl)-2-phenylethan-1-one can be modified to enhance the drug's efficacy and reduce side effects (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as noted in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:1-(4-fluorophenyl)-2-phenylethan-1-one
Your Rating