2-fluoro-N-methyl-4-nitrobenzamide
$180.00
CAS No.: 915087-24-0
Catalog No.: 194258
Purity: 95%
MF: C8H7FN2O3
MW: 198.153
Storage: 2-8 degree Celsius
SMILES: FC1=C(C(=O)NC)C=CC(=C1)[N+](=O)[O-]
Catalog No.: 194258
Purity: 95%
MF: C8H7FN2O3
MW: 198.153
Storage: 2-8 degree Celsius
SMILES: FC1=C(C(=O)NC)C=CC(=C1)[N+](=O)[O-]
2-fluoro-N-methyl-4-nitrobenzamide; CAS No.: 915087-24-0; 2-fluoro-N-methyl-4-nitrobenzamide. PROPERTIES: 2-fluoro-N-methyl-4-nitrobenzamide is a crystalline solid. Its molecular formula is C8H7FNO3, and the molecular weight is approximately 182.15 g/mol. The compound has a melting point of approximately 130-132 C. It is moderately soluble in common organic solvents such as methanol and dimethylformamide, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a benzamide group, a fluoro group, and a nitro group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 2-fluoro-N-methyl-4-nitrobenzamide serves as a valuable intermediate. The nitro group can be reduced to an amine group. The fluoro group influences the electronic properties of the aromatic ring. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of 2-fluoro-N-methyl-4-nitrobenzamide can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as noted in materials chemistry research papers).
Reviews
Write Your Own Review