Thiamet G
$400.00
CAS No.: 1009816-48-1
Catalog No.: 141880
Purity: 95%
MF: C9H16N2O4S
MW: 248.304
Storage: 2-8 degree Celsius
SMILES: CCNC1=N[C@H]2[C@H](O[C@H](CO)[C@@H](O)[C@@H]2O)S1
Catalog No.: 141880
Purity: 95%
MF: C9H16N2O4S
MW: 248.304
Storage: 2-8 degree Celsius
SMILES: CCNC1=N[C@H]2[C@H](O[C@H](CO)[C@@H](O)[C@@H]2O)S1
(3aR,5R,6S,7R,7aR)-2-(ethylamino)-5-(hydroxymethyl)-3aH,5H,6H,7H,7aH-pyrano[3,2-d][1,3]thiazole-6,7-diol; CAS No.: 1009816-48-1 - This chemical is a key intermediate in the synthesis of complex organic molecules, particularly in the pharmaceutical industry. Its availability through ChemShuttle's platform facilitates efficient research and development processes.
Reviews
Write Your Own Review