T0901317
$300.00
CAS No.: 293754-55-9
Catalog No.: 141850
Purity: 95%
MF: C17H12F9NO3S
MW: 481.336
Storage: 2-8 degree Celsius
SMILES: OC(C1=CC=C(C=C1)N(CC(F)(F)F)S(=O)(=O)C1=CC=CC=C1)(C(F)(F)F)C(F)(F)F
Catalog No.: 141850
Purity: 95%
MF: C17H12F9NO3S
MW: 481.336
Storage: 2-8 degree Celsius
SMILES: OC(C1=CC=C(C=C1)N(CC(F)(F)F)S(=O)(=O)C1=CC=CC=C1)(C(F)(F)F)C(F)(F)F
N-(4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl)-N-(2,2,2-trifluoroethyl)benzenesulfonamide; CAS No.: 330808-88-3 This substance is known for its specific chemical characteristics and is used in the production of specialty chemicals. Its applications include the synthesis of complex organic molecules for various industrial uses.
Reviews
Write Your Own Review