![3-?oxaspiro[5.5]?undecan-?9-?one](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171583_1.jpg)
![tert-butyl 2-oxo-1,8-diazaspiro[4.5]decane-8-carboxylate](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171593_1.jpg)
tert-butyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate
$195.00
CAS No.: 1158750-91-4
Catalog No.: 171592
Purity: 95%
MF: C13H22N2O3
MW: 254.33
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCCC2(CNC(=O)C2)C1
Catalog No.: 171592
Purity: 95%
MF: C13H22N2O3
MW: 254.33
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCCC2(CNC(=O)C2)C1
tert-butyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate; CAS No.: 1158750-91-4; tert-butyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate is a chem block offered by ChemShuttle, a chemical synthesis company. As a pharma building block, it is crucial in custom synthesis for small molecules synthesis. The spirocyclic structure with the oxo and protected amino groups is a unique framework. It can be used to create novel molecules with specific conformations, which may have enhanced biological activity. This compound provides chemists with a starting point to design and synthesize complex pharmaceutical agents.
Reviews
Write Your Own Review