![tert-butyl 3-oxo-2,7-diazaspiro[4.5]decane-7-carboxylate](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171592_1.jpg)
![tert-butyl 1-amino-7-azaspiro[3.5]nonane-7-carboxylate hydrochloride](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171646_1.jpg)
tert-butyl 2-oxo-1,8-diazaspiro[4.5]decane-8-carboxylate
$245.00
CAS No.: 1158749-94-0
Catalog No.: 171593
Purity: 95%
MF: C13H22N2O3
MW: 254.33
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCC2(CCC(=O)N2)CC1
Catalog No.: 171593
Purity: 95%
MF: C13H22N2O3
MW: 254.33
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCC2(CCC(=O)N2)CC1
tert-butyl 2-oxo-1,8-diazaspiro[4.5]decane-8-carboxylate; CAS No.: 1158749-94-0; tert-butyl 2-oxo-1,8-diazaspiro[4.5]decane-8-carboxylate is a heterocycle provided by ChemShuttle, a custom chemical synthesis company. It functions as a screening compound in CRO chemical synthesis. The spirocyclic diaza structure with the oxo and protected carboxylate group makes it an interesting candidate for screening. It may have the potential to interact with biological targets in ways that could lead to the discovery of new drugs. Its structure can be modified to optimize its activity, making it a valuable asset in the drug discovery process.
Reviews
Write Your Own Review