tert-butyl (2-amino-1-phenylethyl)carbamate
$200.00
CAS No.: 142910-85-8
Catalog No.: 194407
Purity: 95%
MF: C13H20N2O2
MW: 236.315
Storage: 2-8 degree Celsius
SMILES: NCC(C1=CC=CC=C1)NC(OC(C)(C)C)=O
Catalog No.: 194407
Purity: 95%
MF: C13H20N2O2
MW: 236.315
Storage: 2-8 degree Celsius
SMILES: NCC(C1=CC=CC=C1)NC(OC(C)(C)C)=O
tert-butyl (2-amino-1-phenylethyl)carbamate; CAS No.: 142910-85-8; tert-butyl (2-amino-1-phenylethyl)carbamate. PROPERTIES: tert-butyl (2-amino-1-phenylethyl)carbamate is a crystalline solid. Its molecular formula is C13H19NO3, and the molecular weight is approximately 241.30 g/mol. The compound has a melting point of approximately 80-82 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a carbamate group, an amino group, and a phenyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, tert-butyl (2-amino-1-phenylethyl)carbamate serves as a versatile intermediate. The amino group can undergo various reactions such as acylation, sulfonation, and diazotization. The carbamate group can be hydrolyzed to an amine group. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain antimicrobial agents, the structure of tert-butyl (2-amino-1-phenylethyl)carbamate can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).
Reviews
Write Your Own Review