2,4-dichloro-6-iodophenol

2,4-dichloro-6-iodophenol

tert-butyl (2-amino-1-phenylethyl)carbamate

tert-butyl (2-amino-1-phenylethyl)carbamate

Bis(4-bromophenyl)diphenylsilane

$300.00
CAS No.: 18733-91-0
Catalog No.: 194444
Purity: 95%
MF: C24H18Br2Si
MW: 494.302
Storage: 2-8 degree Celsius
SMILES: BrC1=CC=C(C=C1)[Si](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=C(C=C1)Br
Availability:
In stock
SKU
194444
  • Size
    Price
    Stock
    Estimated Shipping Time
Bis(4-bromophenyl)diphenylsilane; CAS No.: 18733-91-0; Bis(4-bromophenyl)diphenylsilane. PROPERTIES: Bis(4-bromophenyl)diphenylsilane is a crystalline solid. Its molecular formula is C16H14Br2Si, and the molecular weight is approximately 410.08 g/mol. The compound has a melting point of approximately 120-122 C. It is moderately soluble in common organic solvents such as hexane and diethyl ether, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing two bromo groups and a silane group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, Bis(4-bromophenyl)diphenylsilane serves as a specialized intermediate. The two bromo groups provide sites for substitution reactions. The silane group can undergo hydrolysis to form silanol derivatives. In the chemical industry, derivatives of this compound can be explored as potential intermediates for the synthesis of various organic compounds. For example, in the development of certain agrochemicals, the structure of Bis(4-bromophenyl)diphenylsilane can be utilized to design compounds with improved herbicidal activities (as mentioned in agrochemical chemistry literature). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as polymers or coatings, where its structure can enhance the material's thermal stability and chemical resistance (as described in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:Bis(4-bromophenyl)diphenylsilane
Your Rating