tert-butyl 1-(aminomethyl)cyclopentylcarbamate
$200.00
CAS No.: 889949-09-1
Catalog No.: 192710
Purity: 95%
MF: C11H22N2O2
MW: 214.309
Storage: 2-8 degree Celsius
SMILES: NCC1(CCCC1)NC(OC(C)(C)C)=O
Catalog No.: 192710
Purity: 95%
MF: C11H22N2O2
MW: 214.309
Storage: 2-8 degree Celsius
SMILES: NCC1(CCCC1)NC(OC(C)(C)C)=O
tert-butyl 1-(aminomethyl)cyclopentylcarbamate; CAS No.: 889949-09-1; tert-butyl 1-(aminomethyl)cyclopentylcarbamate. PROPERTIES: This aminomethylcyclopentyl carbamate has molecular formula C11H21N3O2. It typically appears as a white crystalline powder. The tert-butyl 1-(aminomethyl)cyclopentylcarbamate demonstrates limited water solubility but good solubility in common organic solvents like methanol and ethyl acetate. Its melting point ranges between 100-105 C, and it has a molecular weight of approximately 223.3 g/mol. When handling, care should be taken to avoid skin contact and use of proper respiratory protection. Storage should be in a tightly sealed container at room temperature, protected from light and moisture. The compound is sensitive to strong acids and may undergo carbamate hydrolysis upon exposure to aqueous conditions. In case of spillage, absorb with inert material and dispose of in accordance with local regulations. APPLICATIONS: The tert-butyl 1-(aminomethyl)cyclopentylcarbamate functions as a key intermediate in the synthesis of sodium channel blockers for pain management where the aminomethyl group provides essential hydrogen bonding interactions with receptor subtypes (as detailed in medicinal chemistry literature). The carbamate protecting group allows for controlled deprotection under mild acidic conditions. Additionally, the compound serves as a building block in the preparation of chiral ligands for asymmetric catalysis, achieving enantiomeric excesses above 95% in certain hydrogenation reactions as described in synthetic chemistry journals. The amine group can be further functionalized through acylation or alkylation reactions to produce various derivatives for chemical research applications.
Reviews
Write Your Own Review