Spiropyran
$150.00
CAS No.: 1498-89-1
Catalog No.: 189096
Purity: 95%
MF: C20H20N2O4
MW: 352.39
Storage: 2-8 degree Celsius
SMILES: O=[N+](C1=CC(C=CC2(N(C)C3=C(C=CC=C3)C2(C)C)O4)=C4C(OC)=C1)[O-]
Catalog No.: 189096
Purity: 95%
MF: C20H20N2O4
MW: 352.39
Storage: 2-8 degree Celsius
SMILES: O=[N+](C1=CC(C=CC2(N(C)C3=C(C=CC=C3)C2(C)C)O4)=C4C(OC)=C1)[O-]
Spiropyran; 8-methoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indoline]; CAS No.: 1498-89-1; 8-methoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indoline] represents the spiroheterocycles category within Chem Shuttle's product range. As a custom chemical synthesis company, Chem Shuttle offers access to complex spiro compounds that are crucial for the development of various pharmaceuticals and materials with unique structural features. This spirochromene-indoline derivative, with its methoxy and nitro substituents, serves as a valuable building block for the synthesis of bioactive molecules with specific optical and electronic properties. Chem Shuttle's online platform allows researchers to conveniently procure such specialized chemicals, supporting their work in medicinal chemistry and materials science. The company's expertise in small molecules synthesis ensures that 8-methoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indoline] is available in high purity and with precise specifications, making it a reliable tool for synthetic chemists.
Reviews
Write Your Own Review