Spirooxazine
$295.00
CAS No.: 27333-47-7
Catalog No.: 189097
Purity: 95%
MF: C22H20N2O
MW: 328.415
Storage: 2-8 degree Celsius
SMILES: CC1(C)C2(OC3=CC=C4C=CC=CC4=C3N=C2)N(C)C5=C1C=CC=C5
Catalog No.: 189097
Purity: 95%
MF: C22H20N2O
MW: 328.415
Storage: 2-8 degree Celsius
SMILES: CC1(C)C2(OC3=CC=C4C=CC=CC4=C3N=C2)N(C)C5=C1C=CC=C5
Spirooxazine; 1,3,3-trimethylspiro[indoline-2,3'-naphtho[2,1-b][1,4]oxazine]; CAS No.: 27333-47-7; 1,3,3-trimethylspiro[indoline-2,3'-naphtho[2,1-b][1,4]oxazine] exemplifies the spirooxazine category within Chem Shuttle's product offerings. As a leading chemicals distributor, Chem Shuttle provides access to complex spiroheterocycles that are essential for the development of various pharmaceuticals and materials with unique structural and functional characteristics. This spiro[indoline-naphthoxazine] derivative serves as a valuable building block for the synthesis of photochromic materials and bioactive molecules. Chem Shuttle's custom compound synthesis services allow for the production of such specialized chemicals to exact specifications, supporting the discovery of novel therapeutic agents and advanced materials. The company's focus on chemical blocks ensures that researchers can obtain high-purity 1,3,3-trimethylspiro[indoline-2,3'-naphtho[2,1-b][1,4]oxazine], facilitating advancements in medicinal chemistry and materials science.
Reviews
Write Your Own Review