Coelenterazine 400a
$702.00
CAS No.: 70217-82-2
Catalog No.: TQP1618
Purity: 95%
MF: C26H21N3O
MW: 391.474
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)C=1N=C2N(C=C(N=C2CC2=CC=CC=C2)C2=CC=CC=C2)C1O
Catalog No.: TQP1618
Purity: 95%
MF: C26H21N3O
MW: 391.474
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)C=1N=C2N(C=C(N=C2CC2=CC=CC=C2)C2=CC=CC=C2)C1O
CAS No.:70217-82-2; Coelenterazine 400a. Coelenterazine 400a (CAS No.:70217-82-2), a blue-shifted luciferin, is a key intermediate for multiplexed bioluminescence assays. ChemShuttle’s process chemistry expertise includes stabilization of CAS No.:70217-82-2 against auto-oxidation. As a key intermediate, it enables dual-reporter systems in drug screening platforms. Our process chemistry team optimizes Coelenterazine 400a (CAS No.:70217-82-2) synthesis for enhanced quantum yield. This key intermediate supports CRISPR-based functional genomics studies. ChemShuttle’s process chemistry capabilities ensure reproducible production of CAS No.:70217-82-2.
Reviews
Write Your Own Review