Parecoxib Sodium
$150.00
CAS No.: 198470-85-8
Catalog No.: 171843
Purity: 95%
MF: C19H17N2NaO4S
MW: 392.412
Storage: 2-8 degree Celsius
SMILES: [Na+].CCC(=O)[N-]S(=O)(=O)C1=CC=C(C=C1)C1=C(C)ON=C1C1=CC=CC=C1
Catalog No.: 171843
Purity: 95%
MF: C19H17N2NaO4S
MW: 392.412
Storage: 2-8 degree Celsius
SMILES: [Na+].CCC(=O)[N-]S(=O)(=O)C1=CC=C(C=C1)C1=C(C)ON=C1C1=CC=CC=C1
sodium ((4-(5-methyl-3-phenylisoxazol-4-yl)phenyl)sulfonyl)(propionyl)amide; CAS No.: 198470-85-8; This chemical is a key intermediate in the synthesis of heterocyclic compounds, offering advantages such as high reactivity and compatibility with various synthetic routes. ChemShuttle offers this product among its 80,000+ catalog, ensuring quick delivery from US-based warehouses for efficient research and development.
Reviews
Write Your Own Review