Jaceosidin
$500.00
CAS No.: 18085-97-7
Catalog No.: ZB1886
Purity: 95%
MF: C17H14O7
MW: 330.292
Storage: 2-8 degree Celsius
SMILES: OC1=C2C(C=C(OC2=CC(=C1OC)O)C1=CC(=C(C=C1)O)OC)=O
Catalog No.: ZB1886
Purity: 95%
MF: C17H14O7
MW: 330.292
Storage: 2-8 degree Celsius
SMILES: OC1=C2C(C=C(OC2=CC(=C1OC)O)C1=CC(=C(C=C1)O)OC)=O
Jaceosidin; 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-methoxy-4H-chromen-4-one; CAS No.: 18085-97-7; ChemShuttle, a custom chemical synthesis company, provides a comprehensive Library of Compounds, including the specialized molecule 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-methoxy-4H-chromen-4-one. This compound is a key intermediate in the synthesis of complex organic molecules and has potential applications in the development of novel pharmaceuticals. The company's expertise in Small molecules synthesis allows for the precise production of this compound, ensuring its quality and reliability for research purposes. As a worldwide chemical supplier, ChemShuttle ensures that researchers and industries have access to this crucial building block, supporting innovation in drug discovery and chemical research. Through their reliable custom synthesis services, ChemShuttle continues to contribute to the advancement of scientific endeavors across the globe.
Reviews
Write Your Own Review