(R)-1-(2-chloropyridin-4-yl)ethan-1-amine dihydrochloride
$300.00
CAS No.: 1391443-90-5
Catalog No.: 189754
Purity: 95%
MF: C7H11Cl3N2
MW: 229.538
Storage: 2-8 degree Celsius
SMILES: Cl.Cl.ClC1=NC=CC(=C1)[C@@H](C)N
Catalog No.: 189754
Purity: 95%
MF: C7H11Cl3N2
MW: 229.538
Storage: 2-8 degree Celsius
SMILES: Cl.Cl.ClC1=NC=CC(=C1)[C@@H](C)N
(R)-1-(2-chloropyridin-4-yl)ethan-1-amine dihydrochloride; CAS No.: 1391443-90-5; As a chemical synthesis company, ChemShuttle delivers various organic chemicals such as (R)-1-(2-chloropyridin-4-yl)ethan-1-amine dihydrochloride, a chiral chloro-substituted pyridine used in medicinal chemistry. The company ensures reliable supply and custom synthesis capabilities.
Reviews
Write Your Own Review