![1-((2,3-dihydrobenzo[b][1,4]dioxin-2-yl)methyl)piperidine hydrochloride](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/z/b/zb0033_1.jpg)
N,N-diethyl-4-(phenyl(piperidin-4-ylidene)methyl)benzamide hydrochloride
$200.00
CAS No.: 209808-47-9
Catalog No.: ZB0027
Purity: 95%
MF: C23H29ClN2O
MW: 384.951
Storage: 2-8 degree Celsius
SMILES: Cl.C(C)N(C(C1=CC=C(C=C1)C(=C1CCNCC1)C1=CC=CC=C1)=O)CC
Catalog No.: ZB0027
Purity: 95%
MF: C23H29ClN2O
MW: 384.951
Storage: 2-8 degree Celsius
SMILES: Cl.C(C)N(C(C1=CC=C(C=C1)C(=C1CCNCC1)C1=CC=CC=C1)=O)CC
N,N-diethyl-4-(phenyl(piperidin-4-ylidene)methyl)benzamide hydrochloride; CAS No.: 209808-47-9; N,N-diethyl-4-(phenyl(piperidin-4-ylidene)methyl)benzamide hydrochloride exemplifies ChemShuttle's provision of piperidine-containing amides in their building blocks for drug discovery. As a custom chemical synthesis company specializing in Small molecules synthesis, ChemShuttle delivers these N,N-diethyl benzamides crucial for developing antipsychotic agents and other CNS therapeutics. The hydrochloride salt form ensures improved solubility and handling characteristics. Their status as a worldwide chemical supplier ensures these compounds are accessible to research teams globally. ChemShuttle's focus on producing high-purity materials with correct amide bond formation helps researchers establish confident structure-activity relationships in their medicinal chemistry studies.
Reviews
Write Your Own Review