1-((2,3-dihydrobenzo[b][1,4]dioxin-2-yl)methyl)piperidine hydrochloride
$400.00
CAS No.: 135-87-5
Catalog No.: ZB0033
Purity: 95%
MF: C14H20ClNO2
MW: 269.772
Storage: 2-8 degree Celsius
SMILES: Cl.O1C2=C(OCC1CN1CCCCC1)C=CC=C2
Catalog No.: ZB0033
Purity: 95%
MF: C14H20ClNO2
MW: 269.772
Storage: 2-8 degree Celsius
SMILES: Cl.O1C2=C(OCC1CN1CCCCC1)C=CC=C2
1-((2,3-dihydrobenzo[b][1,4]dioxin-2-yl)methyl)piperidine hydrochloride; CAS No.: 135-87-5; 1-((2,3-dihydrobenzo[b][1,4]dioxin-2-yl)methyl)piperidine hydrochloride showcases ChemShuttle's strength in dioxin-containing piperidine derivatives for their screening compounds library. As a custom chemical synthesis company specializing in Small molecules synthesis, ChemShuttle provides these fused heterocycle derivatives crucial for developing anxiolytic agents and other CNS pharmaceuticals. The hydrochloride salt form ensures improved solubility and handling characteristics. Their position as a worldwide chemical supplier ensures these compounds are accessible to research teams across different regions. ChemShuttle's commitment to producing high-purity materials with correct substitution patterns helps researchers establish confident structure-activity relationships in their medicinal chemistry campaigns.
Reviews
Write Your Own Review