(Z)-N-hydroxy-4-(trifluoromethyl)benzimidoylchloride

(Z)-N-hydroxy-4-(trifluoromethyl)benzimidoylchloride

methyl 4-cyano-2-(trifluoromethyl)benzoate

methyl 4-cyano-2-(trifluoromethyl)benzoate

methyl 4-hydroxy-2-(trifluoromethyl)benzoate

$250.00
CAS No.: 790695-49-7
Catalog No.: 194156
Purity: 95%
MF: C9H7F3O3
MW: 220.146
Storage: 2-8 degree Celsius
SMILES: OC1=CC(=C(C(=O)OC)C=C1)C(F)(F)F
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194156
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 4-hydroxy-2-(trifluoromethyl)benzoate; CAS No.: 790695-49-7; methyl 4-hydroxy-2-(trifluoromethyl)benzoate. PROPERTIES: methyl 4-hydroxy-2-(trifluoromethyl)benzoate is a crystalline solid. Its molecular formula is C10H7F3O3, and the molecular weight is approximately 240.16 g/mol. The compound has a melting point of approximately 70-72 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a hydroxyl group and a trifluoromethyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, methyl 4-hydroxy-2-(trifluoromethyl)benzoate serves as a valuable intermediate. The hydroxyl group can undergo reactions such as etherification and esterification, and the trifluoromethyl group provides strong electron-withdrawing effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain antimicrobial agents, the structure of methyl 4-hydroxy-2-(trifluoromethyl)benzoate can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 4-hydroxy-2-(trifluoromethyl)benzoate
Your Rating