methyl 4-cyano-2-(trifluoromethyl)benzoate
$200.00
CAS No.: 1641588-74-0
Catalog No.: 194154
Purity: 95%
MF: C10H6F3NO2
MW: 229.157
Storage: 2-8 degree Celsius
SMILES: C(#N)C1=CC(=C(C(=O)OC)C=C1)C(F)(F)F
Catalog No.: 194154
Purity: 95%
MF: C10H6F3NO2
MW: 229.157
Storage: 2-8 degree Celsius
SMILES: C(#N)C1=CC(=C(C(=O)OC)C=C1)C(F)(F)F
methyl 4-cyano-2-(trifluoromethyl)benzoate; CAS No.: 1641588-74-0; methyl 4-cyano-2-(trifluoromethyl)benzoate. PROPERTIES: methyl 4-cyano-2-(trifluoromethyl)benzoate is a crystalline solid. Its molecular formula is C11H7F3NO2, and the molecular weight is approximately 236.18 g/mol. The compound has a melting point of approximately 65-67 C. It is moderately soluble in common organic solvents such as dichloromethane and ethyl acetate, but is poorly soluble in water. For stable storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a cyano group and a trifluoromethyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 4-cyano-2-(trifluoromethyl)benzoate serves as a valuable intermediate. The cyano group can be converted to other functional groups such as carboxylic acid or amine, and the trifluoromethyl group provides strong electron-withdrawing effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain antimicrobial agents, the structure of methyl 4-cyano-2-(trifluoromethyl)benzoate can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as mentioned in materials chemistry research papers).
Reviews
Write Your Own Review