methyl 4-fluoro-2,6-dimethylbenzoate
$300.00
CAS No.: 14659-60-0
Catalog No.: 126872
Purity: 95%
MF: C10H11FO2
MW: 182.194
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=C(C)C=C(F)C=C1C
Catalog No.: 126872
Purity: 95%
MF: C10H11FO2
MW: 182.194
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=C(C)C=C(F)C=C1C
methyl 4-fluoro-2,6-dimethylbenzoate; CAS No.: 14659-60-0; methyl 4-fluoro-2,6-dimethylbenzoate is a substituted aromatic ester valuable in synthetic organic chemistry. This compound falls under ChemShuttle's chemical building blocks category, which is crucial for the development of new pharmaceutical entities. As a Leading Chemicals Distributor, ChemShuttle offers custom compound synthesis, enabling scientists to procure this and other similar compounds for advancing their research in drug discovery.
Reviews
Write Your Own Review