methyl 2-amino-6-fluoro-3-nitrobenzoate
$200.00
CAS No.: 346691-23-4
Catalog No.: 126880
Purity: 95%
MF: C8H7FN2O4
MW: 214.152
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=C(F)C=CC(=C1N)[N+]([O-])=O
Catalog No.: 126880
Purity: 95%
MF: C8H7FN2O4
MW: 214.152
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=C(F)C=CC(=C1N)[N+]([O-])=O
methyl 2-amino-6-fluoro-3-nitrobenzoate; CAS No.: 346691-23-4; methyl 2-amino-6-fluoro-3-nitrobenzoate is a multifunctional compound valuable in medicinal chemistry. This compound is part of ChemShuttle's various organic chemicals category, which is crucial for the development of new pharmaceutical entities. As a custom chemical synthesis company, ChemShuttle provides custom compound synthesis services, enabling researchers to access this and other specialized compounds for their experimental protocols.
Reviews
Write Your Own Review