methyl 4-cyano-2-(trifluoromethyl)benzoate

methyl 4-cyano-2-(trifluoromethyl)benzoate

methyl 4-carboxyl-2-fluorobenzoate

methyl 4-carboxyl-2-fluorobenzoate

methyl 4-chloro-5-fluoro-2-nitrobenzoate

$250.00
CAS No.: 1113049-81-2
Catalog No.: 194153
Purity: 95%
MF: C8H5ClFNO4
MW: 233.582
Storage: 2-8 degree Celsius
SMILES: ClC1=CC(=C(C(=O)OC)C=C1F)[N+](=O)[O-]
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194153
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 4-chloro-5-fluoro-2-nitrobenzoate; CAS No.: 1113049-81-2; methyl 4-chloro-5-fluoro-2-nitrobenzoate. PROPERTIES: methyl 4-chloro-5-fluoro-2-nitrobenzoate is a crystalline solid. Its molecular formula is C9H6ClFNO4, and the molecular weight is approximately 237.11 g/mol. The compound has a melting point of approximately 75-77 C. It is moderately soluble in common organic solvents such as acetone and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a chlorinated and fluorinated aromatic compound containing a nitro group and an ester group, it may exhibit certain oxidizing properties and reactivity. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 4-chloro-5-fluoro-2-nitrobenzoate serves as a versatile intermediate. The nitro group can be reduced to an amine group, the chlorine and fluorine atoms provide sites for further substitution or coupling reactions. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anticancer drugs, the structure of methyl 4-chloro-5-fluoro-2-nitrobenzoate can be modified to enhance the drug's ability to target cancer cells and improve its therapeutic index (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as noted in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 4-chloro-5-fluoro-2-nitrobenzoate
Your Rating