methyl 4-amino-3-(tert-butyl)benzoate hydrochloride
$500.00
CAS No.: 2044702-89-6
Catalog No.: 189311
Purity: 95%
MF: C12H18ClNO2
MW: 243.734
Storage: 2-8 degree Celsius
SMILES: Cl.NC1=C(C=C(C(=O)OC)C=C1)C(C)(C)C
Catalog No.: 189311
Purity: 95%
MF: C12H18ClNO2
MW: 243.734
Storage: 2-8 degree Celsius
SMILES: Cl.NC1=C(C=C(C(=O)OC)C=C1)C(C)(C)C
methyl 4-amino-3-(tert-butyl)benzoate hydrochloride; CAS No.: 2044702-89-6; methyl 4-amino-3-(tert-butyl)benzoate hydrochloride exemplifies the aminobenzoate category within Chem Shuttle's product offerings. As a chemical synthesis company, Chem Shuttle provides access to benzoate derivatives with amino and tert-butyl substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its amino and tert-butyl groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's online platform allows researchers to conveniently procure such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in small molecules synthesis ensures that methyl 4-amino-3-(tert-butyl)benzoate hydrochloride is available in high purity and with precise specifications, making it a reliable tool for synthetic chemists.
Reviews
Write Your Own Review