1,2-dibromo-4-methoxy-3,5,6-trimethylbenzene
$350.00
CAS No.: 1359986-20-1
Catalog No.: 189310
Purity: 95%
MF: C10H12Br2O
MW: 308.013
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=C(C(=C1C)C)OC)C)Br
Catalog No.: 189310
Purity: 95%
MF: C10H12Br2O
MW: 308.013
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=C(C(=C1C)C)OC)C)Br
1,2-dibromo-4-methoxy-3,5,6-trimethylbenzene; CAS No.: 1359986-20-1; 1,2-dibromo-4-methoxy-3,5,6-trimethylbenzene represents the polybrominated methoxybenzenes category within Chem Shuttle's product range. As a leading chemicals distributor, Chem Shuttle offers access to benzene derivatives with bromo, methoxy, and methyl substituents that are essential for the synthesis of various pharmaceuticals, materials, and agrochemicals. This compound, with its dibromo, methoxy, and trimethyl groups, serves as a valuable building block for the production of bioactive molecules with specific spatial configurations. Chem Shuttle's custom chemical synthesis services allow for the production of such specialized chemicals to exact specifications, supporting the development of novel therapeutic agents and advanced materials. The company's focus on chemical blocks ensures that researchers can obtain high-purity 1,2-dibromo-4-methoxy-3,5,6-trimethylbenzene, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review