methyl 2-hydroxy-3-nitrobenzoate
$250.00
CAS No.: 22621-41-6
Catalog No.: 189301
Purity: 95%
MF: C8H7NO5
MW: 197.146
Storage: 2-8 degree Celsius
SMILES: OC1=C(C(=O)OC)C=CC=C1[N+](=O)[O-]
Catalog No.: 189301
Purity: 95%
MF: C8H7NO5
MW: 197.146
Storage: 2-8 degree Celsius
SMILES: OC1=C(C(=O)OC)C=CC=C1[N+](=O)[O-]
methyl 2-hydroxy-3-nitrobenzoate; CAS No.: 22621-41-6; methyl 2-hydroxy-3-nitrobenzoate is one of the many hydroxynitrobenzoates available through Chem Shuttle's extensive product offerings. As a leading chemicals distributor, Chem Shuttle offers access to benzoate derivatives with hydroxy and nitro substituents that are essential for the synthesis of various pharmaceuticals, dyes, and agrochemicals. This compound, with its hydroxy and nitro groups, serves as a valuable building block for the production of bioactive molecules with specific spatial configurations. Chem Shuttle's custom chemical synthesis services allow for the production of such specialized chemicals to exact specifications, supporting the development of novel therapeutic agents and advanced materials. The company's focus on chemical blocks ensures that researchers can obtain high-purity methyl 2-hydroxy-3-nitrobenzoate, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review