2-amino-4-(tert-butyl)benzoic acid
$200.00
CAS No.: 728945-64-0
Catalog No.: 189302
Purity: 95%
MF: C11H15NO2
MW: 193.246
Storage: 2-8 degree Celsius
SMILES: NC1=C(C(=O)O)C=CC(=C1)C(C)(C)C
Catalog No.: 189302
Purity: 95%
MF: C11H15NO2
MW: 193.246
Storage: 2-8 degree Celsius
SMILES: NC1=C(C(=O)O)C=CC(=C1)C(C)(C)C
2-amino-4-(tert-butyl)benzoic acid; CAS No.: 728945-64-0; 2-amino-4-(tert-butyl)benzoic acid exemplifies the aminobenzoic acids category within Chem Shuttle's product offerings. As a chemical synthesis company, Chem Shuttle provides access to benzoic acid derivatives with amino and tert-butyl substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its amino and tert-butyl groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's online platform allows researchers to conveniently procure such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in small molecules synthesis ensures that 2-amino-4-(tert-butyl)benzoic acid is available in high purity and with precise specifications, making it a reliable tool for synthetic chemists.
Reviews
Write Your Own Review