![endo-9-Boc-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171606_1.jpg)
![3-oxa-9-azabicyclo[3.3.1]nonan-7-one hydrochloride](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171624_1.jpg)
exo-8-Boc-3-cyano-8-azabicyclo[3.2.1]octane
$180.00
CAS No.: 1147558-40-4
Catalog No.: 171607
Purity: 95%
MF: C13H20N2O2
MW: 236.315
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1[C@H]2CC[C@@H]1C[C@H](C2)C#N
Catalog No.: 171607
Purity: 95%
MF: C13H20N2O2
MW: 236.315
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1[C@H]2CC[C@@H]1C[C@H](C2)C#N
exo-8-Boc-3-cyano-8-azabicyclo[3.2.1]octane; CAS No.: 1147558-40-4; exo-8-Boc-3-cyano-8-azabicyclo[3.2.1]octane is a cycle compound from ChemShuttle, a custom chemical synthesis company. It acts as a key intermediate in small molecules synthesis. The bicyclic structure with the protected amino, cyano group provides a platform for chemical reactions. In custom synthesis, it can be used to build more complex molecules by exploiting the reactivity of these functional groups. This compound is essential for constructing molecules with specific chemical and biological properties, contributing to the development of new chemical products.
Reviews
Write Your Own Review