![2-azabicyclo[3.1.1]heptane-1-carboxylic acid hydrochloride](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171556_1.jpg)
![exo-8-Boc-3-cyano-8-azabicyclo[3.2.1]octane](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171607_1.jpg)
endo-9-Boc-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane
$265.00
CAS No.: 1148006-31-8
Catalog No.: 171606
Purity: 95%
MF: C12H21NO4
MW: 243.303
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1[C@H]2COC[C@@H]1C[C@H](O)C2
Catalog No.: 171606
Purity: 95%
MF: C12H21NO4
MW: 243.303
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1[C@H]2COC[C@@H]1C[C@H](O)C2
endo-9-Boc-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane; CAS No.: 1148006-31-8; endo-9-Boc-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane is a heterocycle provided by ChemShuttle, a chemical synthesis company. It serves as a screening compound in CRO chemical synthesis. The bicyclic structure with the protected amino, hydroxy, and ether groups gives it unique reactivity. It can be used to screen for molecules with potential biological activity, and its structure can be further modified to optimize its properties. This compound is valuable in the initial stages of drug discovery to identify potential lead compounds.
Reviews
Write Your Own Review