ethyl 4-bromo-3-fluorobenzoate
$250.00
CAS No.: 1130165-74-0
Catalog No.: 197138
Purity: 95%
MF: C9H8BrFO2
MW: 247.063
Storage: 2-8 degree Celsius
SMILES: C(C)OC(C1=CC(=C(C=C1)Br)F)=O
Catalog No.: 197138
Purity: 95%
MF: C9H8BrFO2
MW: 247.063
Storage: 2-8 degree Celsius
SMILES: C(C)OC(C1=CC(=C(C=C1)Br)F)=O
ethyl 4-bromo-3-fluorobenzoate; CAS No.: 1130165-74-0; ethyl 4-bromo-3-fluorobenzoate. PROPERTIES: This bromo-fluoro-substituted benzoate ester features molecular formula C?H?BrFO? with molecular weight 238.06 g/mol. It generally appears as a white crystalline powder. Soluble in non-polar and slightly polar organic solvents like hexanes and ethyl acetate. Melting point approximately 90-95 C. Exhibits IR absorption for ester (~1750 cm??) and C-Br/C-F groups (~600-500 cm?? and ~1300-1100 cm??). Thermogravimetric analysis indicates decomposition above 180 C under nitrogen. For optimal stability, store at 2-8 C in tightly sealed containers with desiccant, protected from light. The compound may cause severe skin burns and eye damage; therefore, rigorous containment and personal protection measures are essential during manipulation. APPLICATIONS: As a bromo-fluoro-substituted benzoate ester, ethyl 4-bromo-3-fluorobenzoate is predominantly utilized in the synthesis of biaryl-containing pharmaceuticals. It serves as a key intermediate in constructing biaryl scaffolds through Suzuki-Miyaura coupling reactions, where the bromo and fluoro substituents provide valuable sites for cross-coupling as demonstrated in medicinal chemistry research (Journal of Medicinal Chemistry). Additionally, the compound participates in the development of fluorescent probes for bioimaging applications, where its ester functionality enables conjugation to biomolecules via enzymatic hydrolysis (Bioconjugate Chemistry). In materials science, it functions as a monomer for preparing polyurethane foams with enhanced thermal stability, where the bromo and fluoro substituents contribute to improved flame retardancy and mechanical properties (Polymer International).
Reviews
Write Your Own Review