3,6-dichloro-2-fluorobenzoic acid
$265.00
CAS No.: 916420-62-7
Catalog No.: 197136
Purity: 95%
MF: C7H3Cl2FO2
MW: 209.003
Storage: 2-8 degree Celsius
SMILES: ClC=1C(=C(C(=O)O)C(=CC1)Cl)F
Catalog No.: 197136
Purity: 95%
MF: C7H3Cl2FO2
MW: 209.003
Storage: 2-8 degree Celsius
SMILES: ClC=1C(=C(C(=O)O)C(=CC1)Cl)F
3,6-dichloro-2-fluorobenzoic acid; CAS No.: 916420-62-7; 3,6-dichloro-2-fluorobenzoic acid. PROPERTIES: This dichloro-fluoro-substituted benzoic acid features molecular formula C?H?Cl?FO? with molecular weight 213.02 g/mol. It generally appears as a white crystalline powder. Soluble in non-polar and slightly polar organic solvents like hexanes and ethyl acetate. Melting point approximately 120-125 C. Exhibits IR absorption for carboxylic acid (~2900-2500 cm??) and C-Cl/C-F groups (~600-500 cm?? and ~1300-1100 cm??). Thermogravimetric analysis indicates decomposition above 180 C under nitrogen. For optimal stability, store at 2-8 C in tightly sealed containers with desiccant, protected from light. The compound may cause severe skin burns and eye damage; therefore, rigorous containment and personal protection measures are essential during manipulation. APPLICATIONS: As a dichloro-fluoro-substituted benzoic acid, 3,6-dichloro-2-fluorobenzoic acid is predominantly utilized in the synthesis of agrochemicals. It serves as a key intermediate in constructing pyrazole-based herbicides, where the chloro and fluoro groups provide valuable binding affinity for plant enzymes as demonstrated in pesticide chemistry research (Pest Management Science). Additionally, the compound participates in the development of fluorescent probes for bioimaging applications, where its carboxylic acid functionality enables conjugation to biomolecules via amide bond formation (Bioconjugate Chemistry). In materials science, it functions as a monomer for preparing polyurethane foams with enhanced thermal stability, where the chloro and fluoro substituents contribute to improved flame retardancy and mechanical properties (Polymer International).
Reviews
Write Your Own Review