ethyl 2,4,6-trichlorobenzoate
$200.00
CAS No.: 73981-96-1
Catalog No.: 197076
Purity: 95%
MF: C9H7Cl3O2
MW: 253.512
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C(=O)OCC)C(=CC(=C1)Cl)Cl
Catalog No.: 197076
Purity: 95%
MF: C9H7Cl3O2
MW: 253.512
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C(=O)OCC)C(=CC(=C1)Cl)Cl
ethyl 2,4,6-trichlorobenzoate; CAS No.: 73981-96-1; ethyl 2,4,6-trichlorobenzoate. PROPERTIES: This trichloro-substituted benzoate ester features molecular formula C?H?Cl?O? with molecular weight 255.49 g/mol. It generally appears as a white crystalline powder. Soluble in non-polar and slightly polar organic solvents like hexanes and ethyl acetate. Melting point approximately 90-95 C. Exhibits IR absorption for ester (~1750 cm??) and C-Cl groups (~600-500 cm??). Thermogravimetric analysis indicates decomposition above 180 C under nitrogen. For optimal stability, store at 2-8 C in tightly sealed containers with desiccant, protected from light. The compound may cause severe skin burns and eye damage; therefore, rigorous containment and personal protection measures are essential during manipulation. APPLICATIONS: As a trichloro-substituted benzoate ester, ethyl 2,4,6-trichlorobenzoate is predominantly utilized in the synthesis of agrochemicals. It serves as a key intermediate in constructing pyrazole-based herbicides, where the chloro groups provide valuable binding affinity for plant enzymes as demonstrated in pesticide chemistry research (Pest Management Science). Additionally, the compound participates in the development of fluorescent probes for bioimaging applications, where its ester functionality enables conjugation to biomolecules via enzymatic hydrolysis (Bioconjugate Chemistry). In materials science, it functions as a monomer for preparing polyurethane foams with enhanced thermal stability, where the chloro substituents contribute to improved flame retardancy and mechanical properties (Polymer International).
Reviews
Write Your Own Review