•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Reference Compounds

Set Ascending Direction

   

Items 61 to 70 of 2247 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. Astemizole

    CAS No.: 68844-77-9
    Catalog No.: 193743
    Purity: 95%
    MF: C28H31FN4O
    MW: 458.581
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(CN2C(=NC3=C2C=CC=C3)NC3CCN(CC3)CCC3=CC=C(C=C3)OC)C=C1
  2. SJB2-043

    CAS No.: 63388-44-3
    Catalog No.: 193744
    Purity: 95%
    MF: C17H9NO3
    MW: 275.263
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C=1OC2=C(N1)C(C=1C=CC=CC1C2=O)=O
  3. A939572

    CAS No.: 1032229-33-6
    Catalog No.: 193755
    Purity: 95%
    MF: C20H22ClN3O3
    MW: 387.867
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(OC2CCN(CC2)C(=O)NC2=CC(=CC=C2)C(NC)=O)C=CC=C1
  4. FTI277 HCl

    CAS No.: 180977-34-8
    Catalog No.: 193770
    Purity: 95%
    MF: C22H30ClN3O3S2
    MW: 484.087
    Storage: 2-8 degree Celsius
    SMILES: Cl.N[C@H](CNC1=CC=C(C(=C1)C1=CC=CC=C1)C(=O)N[C@@H](CCSC)C(=O)OC)CS
  5. Buparlisib Hydrochloride

    CAS No.: 1312445-63-8
    Catalog No.: 193775
    Purity: 95%
    MF: C18H22ClF3N6O2
    MW: 446.861
    Storage: 2-8 degree Celsius
    SMILES: Cl.O1CCN(CC1)C1=NC(=CC(=N1)C=1C(=CC(=NC1)N)C(F)(F)F)N1CCOCC1
  6. ((3aR,4R,6R,6aR)-6-((E)-4-(hydroxyimino)-2-oxotetrahydropyrimidin-1(2H)-yl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-yl)methyl isobutyrate

    CAS No.: 2346620-55-9
    Catalog No.: 193778
    Purity: 95%
    MF: C16H25N3O7
    MW: 371.39
    Storage: 2-8 degree Celsius
    SMILES: C(C(C)C)(=O)OC[C@H]1O[C@H]([C@@H]2OC(O[C@@H]21)(C)C)N2C(N/C(/CC2)=N/O)=O
  7. DUN99845

    CAS No.: 727699-84-5
    Catalog No.: 193780
    Purity: 95%
    MF: C26H21FN2O4S
    MW: 476.529
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C=C1)S(=O)(=O)NC=1C=C(C=CC1OC)NC(=O)C1=CC=C(C=C1)C1=CC=CC=C1
  8. MPP+ iodide

    CAS No.: 36913-39-0
    Catalog No.: 193784
    Purity: 95%
    MF: C12H12IN
    MW: 297.139
    Storage: 2-8 degree Celsius
    SMILES: [I-].C[N+]1=CC=C(C=C1)C1=CC=CC=C1
  9. 9-Amino-(9-deoxy)epi-quinine trihydrochloride

    CAS No.: 1231763-32-8
    Catalog No.: 194103
    Purity: 95%
    MF: C20H28Cl3N3O
    MW: 432.823
    Storage: 2-8 degree Celsius
    SMILES: N[C@@H](C1=CC=NC2=CC=C(OC)C=C12)C3[N@@]4C[C@H](C=C)[C@](CC4)([H])C3.[H]Cl.[H]Cl.[H]Cl
  10. Valdecoxib Impurity B

    CAS No.: 1373038-60-8
    Catalog No.: 194206
    Purity: 95%
    MF: C32H25N3O6S2
    MW: 611.701
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(C(=NO1)C1=CC=CC=C1)C1=CC=C(C=C1)S(=O)(=O)NS(=O)(=O)C1=CC=C(C=C1)C=1C(=NOC1C)C1=CC=CC=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 61 to 70 of 2247 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9