•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Reference Compounds

Set Ascending Direction

   

Items 21 to 30 of 2247 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. PSI-6130

    CAS No.: 817204-33-4
    Catalog No.: 193672
    Purity: 95%
    MF: C10H14FN3O4
    MW: 259.237
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC(N(C=C1)[C@@H]1O[C@@H]([C@H]([C@@]1(C)F)O)CO)=O
  2. R-7128;Mericitabine

    CAS No.: 940908-79-2
    Catalog No.: 193673
    Purity: 95%
    MF: C18H26FN3O6
    MW: 399.419
    Storage: 2-8 degree Celsius
    SMILES: C(C(C)C)(=O)O[C@@H]1[C@H](O[C@H]([C@]1(C)F)N1C(N=C(C=C1)N)=O)COC(C(C)C)=O
  3. NS3623

    CAS No.: 343630-41-1
    Catalog No.: 193674
    Purity: 95%
    MF: C15H10BrF3N6O
    MW: 427.184
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC(=C(C=C1)NC(=O)NC1=CC(=CC=C1)C(F)(F)F)C=1N=NNN1
  4. Quiflapon

    CAS No.: 136668-42-3
    Catalog No.: 193678
    Purity: 95%
    MF: C34H35ClN2O3S
    MW: 587.185
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)SC1=C(N(C2=CC=C(C=C12)OCC1=NC2=CC=CC=C2C=C1)CC1=CC=C(C=C1)Cl)CC(C(=O)O)(C)C
  5. IMT1

    CAS No.: 2304621-31-4
    Catalog No.: 193680
    Purity: 95%
    MF: C21H21NO4
    MW: 351.402
    Storage: 2-8 degree Celsius
    SMILES: CN(C(C(C)OC1=CC=C2C(=CC(OC2=C1)=O)C1=C(C=CC=C1)C)=O)C
  6. LDC203974(IMT1B)

    CAS No.: 2304621-06-3
    Catalog No.: 193681
    Purity: 95%
    MF: C24H21ClFNO6
    MW: 473.884
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=CC(=C1)F)C1=CC(OC2=CC(=CC=C12)O[C@@H](C(=O)N1C[C@H](CCC1)C(=O)O)C)=O
  7. Taletrectinib (DS-6051b)

    CAS No.: 1505515-69-4
    Catalog No.: 193685
    Purity: 95%
    MF: C29H34FN5O5
    MW: 551.619
    Storage: 2-8 degree Celsius
    SMILES: C(CCCCC(=O)O)(=O)O.N[C@@H](COC1=CC=C(C=C1)C1=CN=C2N1N=C(C=C2)N[C@H](C)C2=CC(=CC=C2)F)C
  8. WM-3835

    CAS No.: 2229025-70-9
    Catalog No.: 193688
    Purity: 95%
    MF: C20H17FN2O4S
    MW: 400.431
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C=C(C=C1C)C1=CC=CC=C1)C(=O)NNS(=O)(=O)C1=CC(=CC=C1)O
  9. EN4

    CAS No.: 1197824-15-9
    Catalog No.: 193689
    Purity: 95%
    MF: C25H24N2O4
    MW: 416.477
    Storage: 2-8 degree Celsius
    SMILES: C(C=C)(=O)NCC1=CC=C(C(=O)NC2=C(C=CC=C2)OC2=CC=C(C=C2)OCC)C=C1
  10. AG-636

    CAS No.: 1623416-31-8
    Catalog No.: 193690
    Purity: 95%
    MF: C21H17N3O2
    MW: 343.386
    Storage: 2-8 degree Celsius
    SMILES: CN1N=NC2=C1C(=CC(=C2)C2=CC=C(C=C2)C2=C(C=CC=C2)C)C(=O)O
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 2247 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5