•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Quinolines

Set Ascending Direction

   

Items 1 to 10 of 1209 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 4-bromo-6-chloroquinoline

    CAS No.: 1070879-30-9
    Catalog No.: 193790
    Purity: 95%
    MF: C9H5BrClN
    MW: 242.503
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=NC2=CC=C(C=C12)Cl
  2. 6-chloroquinoline-2-carboxylic acid

    CAS No.: 59394-30-8
    Catalog No.: 193794
    Purity: 95%
    MF: C10H6ClNO2
    MW: 207.616
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C2C=CC(=NC2=CC1)C(=O)O
  3. 4-bromoquinolin-6-amine

    CAS No.: 1260785-25-8
    Catalog No.: 193796
    Purity: 95%
    MF: C9H7BrN2
    MW: 223.073
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=NC2=CC=C(C=C12)N
  4. 7-chloro-N-(4-fluoro-3-(((6-methyl-2-(4-methylpiperazin-1-yl)pyrimidin-4-yl)amino)methyl)phenyl)quinolin-4-amine

    CAS No.: 1454697-30-3
    Catalog No.: TQ0020
    Purity: 95%
    MF: C26H27ClFN7
    MW: 492.002
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C2C(=CC=NC2=C1)NC1=CC(=C(C=C1)F)CNC1=NC(=NC(=C1)C)N1CCN(CC1)C
  5. 7-chloro-N-(4-fluoro-3-(((4-methyl-6-(piperidin-1-yl)pyrimidin-2-yl)amino)methyl)phenyl)quinolin-4-amine

    CAS No.: 2299244-05-4
    Catalog No.: TQ0021
    Purity: 95%
    MF: C26H26ClFN6
    MW: 476.987
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C2C(=CC=NC2=C1)NC1=CC(=C(C=C1)F)CNC1=NC(=CC(=N1)C)N1CCCCC1
  6. 4-((6,7-dimethoxyquinolin-4-yl)oxy)-3-fluoroaniline

    CAS No.: 347161-74-4
    Catalog No.: TQ0092
    Purity: 95%
    MF: C17H15FN2O3
    MW: 314.316
    Storage: 2-8 degree Celsius
    SMILES: COC=1C=C2C(=CC=NC2=CC1OC)OC1=C(C=C(N)C=C1)F
  7. 4-((6,7-dimethoxyquinolin-4-yl)oxy)-2-fluoroaniline

    CAS No.: 228559-74-8
    Catalog No.: TQ0093
    Purity: 95%
    MF: C17H15FN2O3
    MW: 314.316
    Storage: 2-8 degree Celsius
    SMILES: COC=1C=C2C(=CC=NC2=CC1OC)OC1=CC(=C(N)C=C1)F
  8. 6,7-dimethyl-2-oxo-1,2-dihydroquinoline-3-carbaldehyde

    CAS No.: 338428-49-2
    Catalog No.: TQ0110
    Purity: 95%
    MF: C12H11NO2
    MW: 201.225
    Storage: 2-8 degree Celsius
    SMILES: CC=1C=C2C=C(C(NC2=CC1C)=O)C=O
  9. 2-chloro-6,7-dimethylquinoline-3-carbaldehyde

    CAS No.: 94856-39-0
    Catalog No.: TQ0111
    Purity: 95%
    MF: C12H10ClNO
    MW: 219.671
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC2=CC(=C(C=C2C=C1C=O)C)C
  10. 6-chloro-2-oxo-1,2-dihydroquinoline-3-carbaldehyde

    CAS No.: 73568-44-2
    Catalog No.: TQ0112
    Purity: 95%
    MF: C10H6ClNO2
    MW: 207.616
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C2C=C(C(NC2=CC1)=O)C=O
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 1209 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5