•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolopyrazines

Set Ascending Direction

   

Items 31 to 37 of 37 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 2-(2,6-dioxopiperidin-3-yl)-5-(4-(methylamino)piperidin-1-yl)isoindoline-1,3-dione

    CAS No.: 2636798-53-1
    Catalog No.: 199629
    Purity: 95%
    MF: C19H22N4O4
    MW: 370.409
    Storage: 2-8 degree Celsius
    SMILES: O=C1NC(CCC1N1C(C2=CC=C(C=C2C1=O)N1CCC(CC1)NC)=O)=O
  2. tert-butyl (5-tosyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)carbamate

    CAS No.: 1201187-44-1
    Catalog No.: WLZ3546
    Purity: 95%
    MF: C18H20N4O4S
    MW: 388.449
    Storage: 2-8 degree Celsius
    SMILES: S(=O)(=O)(C1=CC=C(C)C=C1)N1C=CC=2C1=NC=C(N2)NC(OC(C)(C)C)=O
  3. 2-bromo-6-methyl-5H-pyrrolo[2,3-b]pyrazine

    CAS No.: 1228450-58-5
    Catalog No.: 195742
    Purity: 95%
    MF: C7H6BrN3
    MW: 212.05
    Storage: 2-8 degree Celsius
    SMILES: BrC=1N=C2C(=NC1)NC(=C2)C
  4. 6-phenyl-5H-pyrrolo[2,3-b]pyrazine

    CAS No.: 78605-10-4
    Catalog No.: 196486
    Purity: 95%
    MF: C12H9N3
    MW: 195.225
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C1=CC=2C(=NC=CN2)N1
  5. 3-chloro-7-iodo-5H-pyrrolo[2,3-b]pyrazine

    CAS No.: 1581750-56-2
    Catalog No.: GS3849
    Purity: 95%
    MF: C6H3ClIN3
    MW: 279.468
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CN=C2C(=N1)NC=C2I
  6. 7-bromo-3-chloro-5H-pyrrolo[2,3-b]pyrazine

    CAS No.: 1935445-26-3
    Catalog No.: GS3850
    Purity: 95%
    MF: C6H3BrClN3
    MW: 232.468
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CNC2=NC(=CN=C21)Cl
  7. 2-fluoro-7-iodo-5H-pyrrolo[2,3-b]pyrazine

    CAS No.: 2230713-64-9
    Catalog No.: GS3989
    Purity: 95%
    MF: C6H3FIN3
    MW: 263.013
    Storage: 2-8 degree Celsius
    SMILES: FC=1N=C2C(=NC1)NC=C2I
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 37 of 37 total

  1. 1
  2. 2
  3. 3
  4. 4