•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolopyrazines

Set Descending Direction

   

Items 1 to 10 of 37 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 7-iodo-5H-pyrrolo[2,3-b]pyrazine

    CAS No.: 889451-26-7
    Catalog No.: 169849
    Purity: 95%
    MF: C6H4IN3
    MW: 245.023
    Storage: 2-8 degree Celsius
    SMILES: IC1=CNC2=C1N=CC=N2
  2. 7-iodo-3-methyl-5H-pyrrolo[2,3-b]pyrazine

    CAS No.: 2230713-12-7
    Catalog No.: GS3991
    Purity: 95%
    MF: C7H6IN3
    MW: 259.05
    Storage: 2-8 degree Celsius
    SMILES: IC1=CNC2=NC(=CN=C21)C
  3. 7,7-dimethyl-2,3,4,6,7,8-hexahydro-1H-cyclopenta[4,5]pyrrolo[1,2-a]pyrazin-1-one

    CAS No.: 1346674-23-4
    Catalog No.: HKP0021
    Purity: 95%
    MF: C12H16N2O
    MW: 204.273
    Storage: 2-8 degree Celsius
    SMILES: CC1(CC2=C(C=C3N2CCNC3=O)C1)C
  4. 2-bromo-5-((2-(trimethylsilyl)ethoxy)methyl)-5H-pyrrolo[2,3-b]pyrazine

    CAS No.: 1184926-29-1
    Catalog No.: TQP0765
    Purity: 95%
    MF: C12H18BrN3OSi
    MW: 328.286
    Storage: 2-8 degree Celsius
    SMILES: BrC=1N=C2C(=NC1)N(C=C2)COCC[Si](C)(C)C
  5. 2-bromo-5-((2-(trimethylsilyl)ethoxy)methyl)-5H-pyrrolo[2,3-b]pyrazine-7-carbaldehyde

    CAS No.: 1185428-34-5
    Catalog No.: TQP0766
    Purity: 95%
    MF: C13H18BrN3O2Si
    MW: 356.296
    Storage: 2-8 degree Celsius
    SMILES: BrC=1N=C2C(=NC1)N(C=C2C=O)COCC[Si](C)(C)C
  6. 2-bromo-N-(tert-butyl)-5-((2-(trimethylsilyl)ethoxy)methyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide

    CAS No.: 1413913-54-8
    Catalog No.: TQP0767
    Purity: 95%
    MF: C17H27BrN4O2Si
    MW: 427.419
    Storage: 2-8 degree Celsius
    SMILES: BrC=1N=C2C(=NC1)N(C=C2C(=O)NC(C)(C)C)COCC[Si](C)(C)C
  7. tert-butyl 2-bromo-5H-pyrrolo[2,3-b]pyrazine-5-carboxylate

    CAS No.: 1207625-13-5
    Catalog No.: TQP0768
    Purity: 95%
    MF: C11H12BrN3O2
    MW: 298.14
    Storage: 2-8 degree Celsius
    SMILES: BrC=1N=C2C(=NC1)N(C=C2)C(=O)OC(C)(C)C
  8. 2-bromo-N-(1-hydroxy-2-methylpropan-2-yl)-5-((2-(trimethylsilyl)ethoxy)methyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide

    CAS No.: 1422772-56-2
    Catalog No.: TQP1296
    Purity: 95%
    MF: C17H27BrN4O3Si
    MW: 443.418
    Storage: 2-8 degree Celsius
    SMILES: BrC=1N=C2C(=NC1)N(C=C2C(=O)NC(CO)(C)C)COCC[Si](C)(C)C
  9. 2-bromo-N-isopropyl-5-((2-(trimethylsilyl)ethoxy)methyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide

    CAS No.: 1350713-64-2
    Catalog No.: TQP1338
    Purity: 95%
    MF: C16H25BrN4O2Si
    MW: 413.392
    Storage: 2-8 degree Celsius
    SMILES: BrC=1N=C2C(=NC1)N(C=C2C(=O)NC(C)C)COCC[Si](C)(C)C
  10. 7-bromo-5H-pyrrolo[2,3-b]pyrazine

    CAS No.: 56015-31-7
    Catalog No.: 162383
    Purity: 95%
    MF: C6H4BrN3
    MW: 198.023
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CNC2=C1N=CC=N2
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 37 total

  1. 1
  2. 2
  3. 3
  4. 4