•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrrolidines

Set Ascending Direction

   

Items 41 to 50 of 827 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. (3R,4R)-tert-butyl 3-amino-4-hydroxypyrrolidine-1-carboxylate

    CAS No.: 330681-18-0
    Catalog No.: 193028
    Purity: 95%
    MF: C9H18N2O3
    MW: 202.254
    Storage: 2-8 degree Celsius
    SMILES: N[C@@H]1CN(C[C@H]1O)C(=O)OC(C)(C)C
  2. 1-acetylpyrrolidin-3-one

    CAS No.: 34086-58-3
    Catalog No.: 193029
    Purity: 95%
    MF: C6H9NO2
    MW: 127.143
    Storage: 2-8 degree Celsius
    SMILES: C(C)(=O)N1CC(CC1)=O
  3. (2R,4S)-4-amino-2-methyl-pyrrolidine-1-carboxylic acid tert-butyl ester

    CAS No.: 348165-60-6
    Catalog No.: 193030
    Purity: 95%
    MF: C10H20N2O2
    MW: 200.282
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N1[C@@H](C[C@@H](C1)N)C
  4. (2R,4R)-tert-Butyl4-amino-2-methylpyrrolidine-1-carboxylate

    CAS No.: 348165-63-9
    Catalog No.: 193031
    Purity: 95%
    MF: C10H20N2O2
    MW: 200.282
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N1[C@@H](C[C@H](C1)N)C
  5. (2S,4R)-4-methylpyrrolidine-2-carboxylic acid hydrochloride

    CAS No.: 365280-18-8
    Catalog No.: 193032
    Purity: 95%
    MF: C6H12ClNO2
    MW: 165.62
    Storage: 2-8 degree Celsius
    SMILES: Cl.C[C@@H]1C[C@H](NC1)C(=O)O
  6. (S)-1-benzyl-5-oxopyrrolidine-3-carboxylic acid

    CAS No.: 428518-42-7
    Catalog No.: 193033
    Purity: 95%
    MF: C12H13NO3
    MW: 219.24
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)N1C[C@H](CC1=O)C(=O)O
  7. (3R,4R)-tert-butyl 3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate

    CAS No.: 429673-83-6
    Catalog No.: 193034
    Purity: 95%
    MF: C16H24N2O3
    MW: 292.379
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)N[C@@H]1CN(C[C@H]1O)C(=O)OC(C)(C)C
  8. (3R,4R)-tert-butyl 3-(tert-butoxycarbonyl)-4-hydroxypyrrolidine-1-carboxylate

    CAS No.: 429673-85-8
    Catalog No.: 193035
    Purity: 95%
    MF: C14H25NO5
    MW: 287.356
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)[C@@H]1CN(C[C@@H]1O)C(=O)OC(C)(C)C
  9. ethyl 2-(2-oxopyrrolidin-1-yl)acetate

    CAS No.: 61516-73-2
    Catalog No.: 193036
    Purity: 95%
    MF: C8H13NO3
    MW: 171.196
    Storage: 2-8 degree Celsius
    SMILES: O=C1N(CCC1)CC(=O)OCC
  10. (S)-2-(chloromethyl)-1-methylpyrrolidine hydrochloride

    CAS No.: 67824-38-8
    Catalog No.: 193037
    Purity: 95%
    MF: C6H13Cl2N
    MW: 170.083
    Storage: 2-8 degree Celsius
    SMILES: Cl.ClC[C@H]1N(CCC1)C
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 827 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7