•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrroles

Set Ascending Direction

   

Items 1 to 10 of 141 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. tert-butyl 3-amino-4-cyano-2,5-dihydro-1H-pyrrole-1-carboxylate

    CAS No.: 1227461-24-6
    Catalog No.: 192975
    Purity: 95%
    MF: C10H15N3O2
    MW: 209.249
    Storage: 2-8 degree Celsius
    SMILES: NC=1CN(CC1C#N)C(=O)OC(C)(C)C
  2. ethyl N-Boc-2,5-dihydropyrrole-3-carboxylate

    CAS No.: 146257-00-3
    Catalog No.: 192976
    Purity: 95%
    MF: C12H19NO4
    MW: 241.287
    Storage: 2-8 degree Celsius
    SMILES: C(=O)(OC(C)(C)C)N1CC(=CC1)C(=O)OCC
  3. 1-(prop-2-yn-1-yl)-1H-pyrrole-2,5-dione

    CAS No.: 209395-32-4
    Catalog No.: 194322
    Purity: 95%
    MF: C7H5NO2
    MW: 135.122
    Storage: 2-8 degree Celsius
    SMILES: C(C#C)N1C(C=CC1=O)=O
  4. 6-bromo-2-(2,5-dimethyl-1H-pyrrol-1-yl)-4-methylquinazolin-8-ol

    CAS No.: 2231399-81-6
    Catalog No.: TQR0505
    Purity: 95%
    MF: C15H14BrN3O
    MW: 332.201
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2C(=NC(=NC2=C(C1)O)N1C(=CC=C1C)C)C
  5. 5-methoxy-2-(1H-pyrrol-3-yl)aniline

    CAS No.: 2235410-75-8
    Catalog No.: TQR0542
    Purity: 95%
    MF: C11H12N2O
    MW: 188.23
    Storage: 2-8 degree Celsius
    SMILES: COC=1C=CC(=C(N)C1)C1=CNC=C1
  6. 1-ethyl-5-(3-(4-((3-ethyl-3-hydroxypentyl)oxy)-3-methylphenyl)pentan-3-yl)-1H-pyrrole-2-carboxylic acid

    CAS No.: 2226204-64-2
    Catalog No.: TQR0811
    Purity: 95%
    MF: C26H39NO4
    MW: 429.601
    Storage: 2-8 degree Celsius
    SMILES: C(C)N1C(=CC=C1C(CC)(CC)C1=CC(=C(C=C1)OCCC(CC)(O)CC)C)C(=O)O
  7. (R)-1-((1-(cyclohept-2-en-1-yl)piperidin-4-yl)methyl)-1H-pyrrole-3-carboxylic acid

    CAS No.: 2423058-84-6
    Catalog No.: TQR1095
    Purity: 95%
    MF: C18H26N2O2
    MW: 302.418
    Storage: 2-8 degree Celsius
    SMILES: [C@@H]1(C=CCCCC1)N1CCC(CC1)CN1C=C(C=C1)C(=O)O
  8. 1-((1-(cyclohept-2-en-1-yl)piperidin-4-yl)methyl)-1H-pyrrole-3-carboxylic acid

    CAS No.: 2423059-16-7
    Catalog No.: TQR1096
    Purity: 95%
    MF: C18H26N2O2
    MW: 302.418
    Storage: 2-8 degree Celsius
    SMILES: C1(C=CCCCC1)N1CCC(CC1)CN1C=C(C=C1)C(=O)O
  9. 5-(5-fluoropyridin-2-yl)-1H-pyrrole-2-carboxylic acid

    CAS No.: 2411819-13-9
    Catalog No.: TQR1526
    Purity: 95%
    MF: C10H7FN2O2
    MW: 206.176
    Storage: 2-8 degree Celsius
    SMILES: FC=1C=CC(=NC1)C1=CC=C(N1)C(=O)O
  10. 5-(5-methylpyridin-2-yl)-1H-pyrrole-2-carboxylic acid

    CAS No.: 2411819-11-7
    Catalog No.: TQR1527
    Purity: 95%
    MF: C11H10N2O2
    MW: 202.213
    Storage: 2-8 degree Celsius
    SMILES: CC=1C=CC(=NC1)C1=CC=C(N1)C(=O)O
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 141 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5