•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrazoles

Set Ascending Direction

   

Items 1 to 10 of 842 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. tert-butyl 4-nitro-1H-pyrazole-1-carboxylate

    CAS No.: 1018446-96-2
    Catalog No.: 192864
    Purity: 95%
    MF: C8H11N3O4
    MW: 213.193
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C=1C=NN(C1)C(=O)OC(C)(C)C
  2. 5-carbamoyl-1-methyl-1H-pyrazole-3-carboxylic acid

    CAS No.: 1174878-96-6
    Catalog No.: 192865
    Purity: 95%
    MF: C6H7N3O3
    MW: 169.14
    Storage: 2-8 degree Celsius
    SMILES: C(N)(=O)C1=CC(=NN1C)C(=O)O
  3. 3-(tetrahydrofuran-3-yl)-1H-pyrazol-5-amine

    CAS No.: 1186609-16-4
    Catalog No.: 192866
    Purity: 95%
    MF: C7H11N3O
    MW: 153.185
    Storage: 2-8 degree Celsius
    SMILES: O1CC(CC1)C1=NNC(=C1)N
  4. 2-(3-amino-1H-pyrazol-5-yl)ethanol

    CAS No.: 1425931-98-1
    Catalog No.: 192867
    Purity: 95%
    MF: C5H9N3O
    MW: 127.147
    Storage: 2-8 degree Celsius
    SMILES: NC1=NNC(=C1)CCO
  5. 5-cyano-1-methyl-1H-pyrazole-3-carboxylic acid

    CAS No.: 1519243-10-7
    Catalog No.: 192868
    Purity: 95%
    MF: C6H5N3O2
    MW: 151.125
    Storage: 2-8 degree Celsius
    SMILES: C(#N)C1=CC(=NN1C)C(=O)O
  6. 2-(4-bromo-1H-pyrazol-3-yl)pyridine

    CAS No.: 166196-52-7
    Catalog No.: 192869
    Purity: 95%
    MF: C8H6BrN3
    MW: 224.061
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(=NNC1)C1=NC=CC=C1
  7. ethyl 1,5-diphenyl-1H-pyrazole-3-carboxylate

    CAS No.: 17355-75-8
    Catalog No.: 192870
    Purity: 95%
    MF: C18H16N2O2
    MW: 292.338
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)N1N=C(C=C1C1=CC=CC=C1)C(=O)OCC
  8. 3-(2-fluorophenyl)-1H-pyrazol-4-amine dihydrochloride

    CAS No.: 1788613-48-8
    Catalog No.: 192871
    Purity: 95%
    MF: C9H10Cl2FN3
    MW: 250.104
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.FC1=C(C=CC=C1)C1=NNC=C1N
  9. methyl 5-carbamoyl-1-methyl-1H-pyrazole-3-carboxylate

    CAS No.: 203792-50-1
    Catalog No.: 192872
    Purity: 95%
    MF: C7H9N3O3
    MW: 183.167
    Storage: 2-8 degree Celsius
    SMILES: C(N)(=O)C1=CC(=NN1C)C(=O)OC
  10. methyl 5-cyano-1-methyl-1H-pyrazole-3-carboxylate

    CAS No.: 203792-51-2
    Catalog No.: 192873
    Purity: 95%
    MF: C7H7N3O2
    MW: 165.152
    Storage: 2-8 degree Celsius
    SMILES: C(#N)C1=CC(=NN1C)C(=O)OC
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 842 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5