•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Purines

Set Ascending Direction

   

Items 51 to 60 of 114 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8
  1. N-Isobutyrylguanosine

    CAS No.: 64350-24-9
    Catalog No.: 198000
    Purity: 95%
    MF: C14H19N5O6
    MW: 353.335
    Storage: 2-8 degree Celsius
    SMILES: C(C(C)C)(=O)NC=1NC(C=2N=CN([C@H]3[C@H](O)[C@H](O)[C@@H](CO)O3)C2N1)=O
  2. ((2R,3R,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-bis((tert-butyldimethylsilyl)oxy)tetrahydrofuran-2-yl)methanol

    CAS No.: 69504-15-0
    Catalog No.: 198001
    Purity: 95%
    MF: C22H41N5O4Si2
    MW: 495.773
    Storage: 2-8 degree Celsius
    SMILES: NC1=C2N=CN(C2=NC=N1)[C@H]1[C@@H]([C@@H]([C@H](O1)CO)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C
  3. 2,6-dichloro-7-ethyl-7H-purine

    CAS No.: 190654-80-9
    Catalog No.: GS4194
    Purity: 95%
    MF: C7H6Cl2N4
    MW: 217.059
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=C2N(C=NC2=N1)CC)Cl
  4. 7-benzyl-2,6-dichloropurine

    CAS No.: 56025-87-7
    Catalog No.: GS4195
    Purity: 95%
    MF: C12H8Cl2N4
    MW: 279.13
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)N1C=NC2=NC(=NC(=C12)Cl)Cl
  5. 2,6-dichloro-9-ethyl-9H-purine

    CAS No.: 190655-14-2
    Catalog No.: GS4196
    Purity: 95%
    MF: C7H6Cl2N4
    MW: 217.059
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=C2N=CN(C2=N1)CC)Cl
  6. 2,6-dichloro-9-cyclopentyl-9H-purine

    CAS No.: 211733-67-4
    Catalog No.: GS4197
    Purity: 95%
    MF: C10H10Cl2N4
    MW: 257.124
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=C2N=CN(C2=N1)C1CCCC1)Cl
  7. 7-benzyl-8-bromo-3-methyl-1H-purine-2,6(3H,7H)-dione

    CAS No.: 93703-26-5
    Catalog No.: TQP1680
    Purity: 95%
    MF: C13H11BrN4O2
    MW: 335.161
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)N1C(=NC=2N(C(NC(C12)=O)=O)C)Br
  8. 2-((8-bromo-3-methyl-2,6-dioxo-2,3-dihydro-1H-purin-7(6H)-yl)methyl)benzonitrile

    CAS No.: 485821-27-0
    Catalog No.: TQP1681
    Purity: 95%
    MF: C14H10BrN5O2
    MW: 360.171
    Storage: 2-8 degree Celsius
    SMILES: BrC1=NC=2N(C(NC(C2N1CC1=C(C#N)C=CC=C1)=O)=O)C
  9. 8-bromo-7-(2-chlorobenzyl)-3-methyl-1H-purine-2,6(3H,7H)-dione

    CAS No.: 304880-50-0
    Catalog No.: TQP1682
    Purity: 95%
    MF: C13H10BrClN4O2
    MW: 369.606
    Storage: 2-8 degree Celsius
    SMILES: BrC1=NC=2N(C(NC(C2N1CC1=C(C=CC=C1)Cl)=O)=O)C
  10. 8-bromo-7-(2-bromobenzyl)-3-methyl-1H-purine-2,6(3H,7H)-dione

    CAS No.: 485821-30-5
    Catalog No.: TQP1683
    Purity: 95%
    MF: C13H10Br2N4O2
    MW: 414.057
    Storage: 2-8 degree Celsius
    SMILES: BrC1=NC=2N(C(NC(C2N1CC1=C(C=CC=C1)Br)=O)=O)C
Loading ...Load More ...
Set Ascending Direction

   

Items 51 to 60 of 114 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8