•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Purines

Set Descending Direction

   

Items 61 to 70 of 114 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. 8-bromo-3-methyl-7-(2-methylbenzyl)-1H-purine-2,6(3H,7H)-dione

    CAS No.: 485821-36-1
    Catalog No.: TQP1684
    Purity: 95%
    MF: C14H13BrN4O2
    MW: 349.188
    Storage: 2-8 degree Celsius
    SMILES: BrC1=NC=2N(C(NC(C2N1CC1=C(C=CC=C1)C)=O)=O)C
  2. 6-chloro-9-((2-(trimethylsilyl)ethoxy)methyl)-9H-purine

    CAS No.: 222296-31-3
    Catalog No.: TQP2469
    Purity: 95%
    MF: C11H17ClN4OSi
    MW: 284.823
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2N=CN(C2=NC=N1)COCC[Si](C)(C)C
  3. 2,6-dichloro-9-((2-(trimethylsilyl)ethoxy)methyl)-9H-purine

    CAS No.: 442685-34-9
    Catalog No.: TQP2471
    Purity: 95%
    MF: C11H16Cl2N4OSi
    MW: 319.268
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=C2N=CN(C2=N1)COCC[Si](C)(C)C)Cl
  4. (2R,3R,4S,5R)-2-(2-amino-6-methoxy-9H-purin-9-yl)-5-(hydroxymethyl)-tetrahydrofuran-3,4-diol

    CAS No.: 121032-29-9
    Catalog No.: 101297
    Purity: 95%
    MF: C11H15N5O5
    MW: 297.271
    Storage: 2-8 degree Celsius
    SMILES: COC1=C2N=CN([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C2=NC(N)=N1
  5. 6-chloro-9-((4-methoxy-3,5-dimethylpyridin-2-yl)methyl)-9H-purin-2-amine

    CAS No.: 848695-25-0
    Catalog No.: 101610
    Purity: 95%
    MF: C14H15ClN6O
    MW: 318.768
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(C)C(CN2C=NC3=C(Cl)N=C(N)N=C23)=NC=C1C
  6. (2-(6-amino-9H-purin-9-yl)ethoxy)methylphosphonic acid

    CAS No.: 106941-25-7
    Catalog No.: 101889
    Purity: 95%
    MF: C8H12N5O4P
    MW: 273.189
    Storage: 2-8 degree Celsius
    SMILES: NC1=C2N=CN(CCOCP(O)(O)=O)C2=NC=N1
  7. 2',3'-O-isopropylideneinosine

    CAS No.: 2140-11-6
    Catalog No.: 102273
    Purity: 95%
    MF: C13H16N4O5
    MW: 308.294
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)O[C@@H]2[C@@H](CO)O[C@H]([C@@H]2O1)N1C=NC2=C1N=CN=C2O
  8. 2'-Deoxyadenosine monohydrate

    CAS No.: 16373-93-6
    Catalog No.: 134955
    Purity: 95%
    MF: C10H15N5O4
    MW: 269.261
    Storage: 2-8 degree Celsius
    SMILES: O.NC1=C2N=CN([C@H]3C[C@H](O)[C@@H](CO)O3)C2=NC=N1
  9. 2'-Deoxyinosine

    CAS No.: 890-38-0
    Catalog No.: 134956
    Purity: 95%
    MF: C10H12N4O4
    MW: 252.23
    Storage: 2-8 degree Celsius
    SMILES: OC[C@H]1O[C@H](C[C@@H]1O)N1C=NC2=C1NC=NC2=O
  10. 3,7-diethyl-1H-purine-2,6(3H,7H)-dione

    CAS No.: 53432-04-5
    Catalog No.: 140631
    Purity: 95%
    MF: C9H12N4O2
    MW: 208.221
    Storage: 2-8 degree Celsius
    SMILES: CCN1C=NC2=C1C(=O)NC(=O)N2CC
Loading ...Load More ...
Set Descending Direction

   

Items 61 to 70 of 114 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9