•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indolines

Set Ascending Direction

   

Items 41 to 50 of 179 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)indoline

    CAS No.: 1622173-47-0
    Catalog No.: WLZ3520
    Purity: 95%
    MF: C14H20BNO2
    MW: 245.131
    Storage: 2-8 degree Celsius
    SMILES: CC1(OB(OC1(C)C)C1=C2CCNC2=CC=C1)C
  2. 4,6-difluoroindoline-2,3-dione

    CAS No.: 126674-93-9
    Catalog No.: 105247
    Purity: 95%
    MF: C8H3F2NO2
    MW: 183.113
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC2=C(C(=O)C(=O)N2)C(F)=C1
  3. 5-fluoro-4-methylindoline-2,3-dione

    CAS No.: 757982-25-5
    Catalog No.: 187024
    Purity: 95%
    MF: C9H6FNO2
    MW: 179.15
    Storage: 2-8 degree Celsius
    SMILES: FC=1C(=C2C(C(NC2=CC1)=O)=O)C
  4. 4,6-dichloroindoline-2,3-dione

    CAS No.: 18711-15-4
    Catalog No.: 196228
    Purity: 95%
    MF: C8H3Cl2NO2
    MW: 216.023
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2C(C(NC2=CC(=C1)Cl)=O)=O
  5. 4-bromoindoline-2,3-dione

    CAS No.: 20780-72-7
    Catalog No.: 196229
    Purity: 95%
    MF: C8H4BrNO2
    MW: 226.029
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C(C(NC2=CC=C1)=O)=O
  6. 4-chloroindoline-2,3-dione

    CAS No.: 6344-05-4
    Catalog No.: 196230
    Purity: 95%
    MF: C8H4ClNO2
    MW: 181.578
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C2C(C(NC2=CC=C1)=O)=O
  7. 6-chloroindoline-2,3-dione

    CAS No.: 6341-92-0
    Catalog No.: 196231
    Purity: 95%
    MF: C8H4ClNO2
    MW: 181.578
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C2C(C(NC2=C1)=O)=O
  8. 6-(trifluoromethyl)indoline

    CAS No.: 181513-29-1
    Catalog No.: 196232
    Purity: 95%
    MF: C9H8F3N
    MW: 187.164
    Storage: 2-8 degree Celsius
    SMILES: FC(C1=CC=C2CCNC2=C1)(F)F
  9. 2,3-dioxoindoline-6-carboxylic acid

    CAS No.: 101870-10-4
    Catalog No.: 197858
    Purity: 95%
    MF: C9H5NO4
    MW: 191.142
    Storage: 2-8 degree Celsius
    SMILES: O=C1NC2=CC(=CC=C2C1=O)C(=O)O
  10. 1-propionylindoline-5-sulfonyl chloride

    CAS No.: 868963-99-9
    Catalog No.: GS3142
    Purity: 95%
    MF: C11H12ClNO3S
    MW: 273.741
    Storage: 2-8 degree Celsius
    SMILES: C(CC)(=O)N1CCC2=CC(=CC=C12)S(=O)(=O)Cl
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 179 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7