4-chloroindoline-2,3-dione
$300.00
CAS No.: 6344-05-4
Catalog No.: 196230
Purity: 95%
MF: C8H4ClNO2
MW: 181.578
Storage: 2-8 degree Celsius
SMILES: ClC1=C2C(C(NC2=CC=C1)=O)=O
Catalog No.: 196230
Purity: 95%
MF: C8H4ClNO2
MW: 181.578
Storage: 2-8 degree Celsius
SMILES: ClC1=C2C(C(NC2=CC=C1)=O)=O
4-chloroindoline-2,3-dione; CAS No.: 6344-05-4; 4-chloroindoline-2,3-dione. PROPERTIES: This compound features a 4-chloroindoline-2,3-dione structure, combining a chloro substituent and an indoline-2,3-dione framework. It typically appears as a white to off-white crystalline solid with a molecular weight of approximately 189.6 g/mol (C8H5ClNO2). The melting point ranges between 180-185 C, and it exhibits moderate solubility in common organic solvents like DMSO and DMF while being sparingly soluble in water. Proper storage requires a tightly sealed container in a cool, dry place. Safety considerations include wearing appropriate PPE. It is classified as a skin and eye irritant (GHS07) with the hazard statement H315-H319. APPLICATIONS: 4-Chloroindoline-2,3-dione serves as a versatile intermediate in pharmaceutical and chemical synthesis. Its 4-chloroindoline-2,3-dione structure allows for participation in various reactions, including nucleophilic substitution at the chloro position and electrophilic substitution at the indoline ring. In medicinal chemistry, it is used to develop bioactive molecules targeting kinases, proteases, and G protein-coupled receptors. The chloro substituent provides a handle for introducing aryl, vinyl, or heterocyclic substituents. This compound also functions as a building block in the synthesis of fluorescent dyes and bioconjugation reagents. Academic studies employ it as a model compound in Organic Chemistry journals, focusing on the development of novel chloroindoline derivatives based on the 4-chloroindoline-2,3-dione scaffold.
Reviews
Write Your Own Review