•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indolines

Set Ascending Direction

   

Items 31 to 40 of 179 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. 1,7-dimethylindolin-2-one

    CAS No.: 67358-21-8
    Catalog No.: 192701
    Purity: 95%
    MF: C10H11NO
    MW: 161.204
    Storage: 2-8 degree Celsius
    SMILES: CN1C(CC2=CC=CC(=C12)C)=O
  2. 1,7-dimethylindoline-2,3-dione

    CAS No.: 91790-39-5
    Catalog No.: 192702
    Purity: 95%
    MF: C10H9NO2
    MW: 175.187
    Storage: 2-8 degree Celsius
    SMILES: CN1C(C(C2=CC=CC(=C12)C)=O)=O
  3. tert-butyl 3-amino-5-methoxyindoline-2-carboxylate

    CAS No.: NA
    Catalog No.: 198935
    Purity: 95%
    MF: C14H20N2O3
    MW: 264.325
    Storage: 2-8 degree Celsius
    SMILES: NC1C(NC2=CC=C(C=C12)OC)C(=O)OC(C)(C)C
  4. N-(3-isopropylphenyl)indoline-5-sulfonamide

    CAS No.: NA
    Catalog No.: 198938
    Purity: 95%
    MF: C17H20N2O2S
    MW: 316.426
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)C=1C=C(C=CC1)NS(=O)(=O)C=1C=C2CCNC2=CC1
  5. methyl 3-methyl-2-oxoindoline-3-carboxylate

    CAS No.: 122281-04-3
    Catalog No.: 199170
    Purity: 95%
    MF: C11H11NO3
    MW: 205.213
    Storage: 2-8 degree Celsius
    SMILES: CC1(C(NC2=CC=CC=C12)=O)C(=O)OC
  6. 2-phenylindoline

    CAS No.: 26216-91-1
    Catalog No.: 199296
    Purity: 95%
    MF: C14H13N
    MW: 195.265
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C1NC2=CC=CC=C2C1
  7. 6-chloroindolin-2-one

    CAS No.: 56341-37-8
    Catalog No.: WLZ3259
    Purity: 95%
    MF: C8H6ClNO
    MW: 167.595
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C2CC(NC2=C1)=O
  8. 1-methylindolin-2-one

    CAS No.: 61-70-1
    Catalog No.: WLZ3260
    Purity: 95%
    MF: C9H9NO
    MW: 147.177
    Storage: 2-8 degree Celsius
    SMILES: CN1C(CC2=CC=CC=C12)=O
  9. 6-chloro-5-fluoroindoline-2,3-dione

    CAS No.: 96202-57-2
    Catalog No.: WLZ3335
    Purity: 95%
    MF: C8H3ClFNO2
    MW: 199.568
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=C2C(C(NC2=C1)=O)=O)F
  10. 5-fluoro-7-nitroindoline-2,3-dione

    CAS No.: 954571-39-2
    Catalog No.: WLZ3433
    Purity: 95%
    MF: C8H3FN2O4
    MW: 210.12
    Storage: 2-8 degree Celsius
    SMILES: FC=1C=C2C(C(NC2=C(C1)[N+](=O)[O-])=O)=O
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 40 of 179 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6