methyl 4-amino-3-ethylbenzoate

methyl 4-amino-3-ethylbenzoate

methyl 4-bromo-2,5-dichlorobenzoate

methyl 4-bromo-2,5-dichlorobenzoate

methyl 4-bromo-2,3-dichlorobenzoate

$300.00
CAS No.: 2055839-96-6
Catalog No.: 194145
Purity: 95%
MF: C8H5BrCl2O2
MW: 283.936
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=C(C(=O)OC)C=C1)Cl)Cl
Availability:
In stock
SKU
194145
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 4-bromo-2,3-dichlorobenzoate; CAS No.: 2055839-96-6; methyl 4-bromo-2,3-dichlorobenzoate. PROPERTIES: methyl 4-bromo-2,3-dichlorobenzoate is a crystalline solid. Its molecular formula is C9H5BrCl2O2, and the molecular weight is approximately 286.45 g/mol. The compound has a melting point of approximately 70-72 C. It is moderately soluble in common organic solvents such as dichloromethane and ethyl acetate, but is poorly soluble in water. For stable storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a brominated and dichlorinated aromatic compound containing an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 4-bromo-2,3-dichlorobenzoate serves as a specialized intermediate. The bromine and chlorine atoms provide multiple sites for substitution reactions, and the ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anticancer drugs, the structure of methyl 4-bromo-2,3-dichlorobenzoate can be modified to enhance the drug's ability to target cancer cells and improve its therapeutic index (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as noted in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 4-bromo-2,3-dichlorobenzoate
Your Rating