methyl 4-amino-3-ethylbenzoate
$350.00
CAS No.: 153304-75-7
Catalog No.: 194144
Purity: 95%
MF: C10H13NO2
MW: 179.219
Storage: 2-8 degree Celsius
SMILES: NC1=C(C=C(C(=O)OC)C=C1)CC
Catalog No.: 194144
Purity: 95%
MF: C10H13NO2
MW: 179.219
Storage: 2-8 degree Celsius
SMILES: NC1=C(C=C(C(=O)OC)C=C1)CC
methyl 4-amino-3-ethylbenzoate; CAS No.: 153304-75-7; methyl 4-amino-3-ethylbenzoate. PROPERTIES: methyl 4-amino-3-ethylbenzoate is a crystalline solid. Its molecular formula is C11H13NO2, and the molecular weight is approximately 191.23 g/mol. The compound has a melting point of approximately 100-102 C. It is slightly soluble in water but dissolves well in organic solvents such as ethyl acetate and tetrahydrofuran. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an amino group and an ethyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 4-amino-3-ethylbenzoate serves as a versatile intermediate. The amino group can undergo various reactions such as acylation, sulfonation, and diazotization. The ethyl group provides steric effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain anti-inflammatory drugs, the structure of methyl 4-amino-3-ethylbenzoate can be modified to enhance the drug's efficacy and reduce side effects (as described in medicinal chemistry research articles). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).
Reviews
Write Your Own Review