methyl 2,4-bis(trifluoromethyl)benzoate

methyl 2,4-bis(trifluoromethyl)benzoate

methyl 2-amino-4-bromo-6-fluorobenzoate

methyl 2-amino-4-bromo-6-fluorobenzoate

methyl 2,4-dichloro-6-fluorobenzoate

$300.00
CAS No.: 1398504-37-4
Catalog No.: 194115
Purity: 95%
MF: C8H5Cl2FO2
MW: 223.03
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C(=O)OC)C(=CC(=C1)Cl)F
Availability:
In stock
SKU
194115
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 2,4-dichloro-6-fluorobenzoate; CAS No.: 1398504-37-4; methyl 2,4-dichloro-6-fluorobenzoate. PROPERTIES: methyl 2,4-dichloro-6-fluorobenzoate is a crystalline solid. Its molecular formula is C9H5Cl2F O2, and the molecular weight is approximately 234.04 g/mol. The compound has a melting point of approximately 55-57 C. It is moderately soluble in common organic solvents such as dichloromethane and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a halogenated aromatic compound containing an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 2,4-dichloro-6-fluorobenzoate serves as a versatile intermediate. The two chloro groups and the fluoro group provide multiple sites for substitution reactions, and the ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of methyl 2,4-dichloro-6-fluorobenzoate can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 2,4-dichloro-6-fluorobenzoate
Your Rating