methyl 2,3,5-trichloro-4-methylbenzoate

methyl 2,3,5-trichloro-4-methylbenzoate

methyl 2,4-dichloro-6-fluorobenzoate

methyl 2,4-dichloro-6-fluorobenzoate

methyl 2,4-bis(trifluoromethyl)benzoate

$300.00
CAS No.: 50870-31-0
Catalog No.: 194114
Purity: 95%
MF: C10H6F6O2
MW: 272.144
Storage: 2-8 degree Celsius
SMILES: FC(C1=C(C(=O)OC)C=CC(=C1)C(F)(F)F)(F)F
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194114
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 2,4-bis(trifluoromethyl)benzoate; CAS No.: 50870-31-0; methyl 2,4-bis(trifluoromethyl)benzoate. PROPERTIES: methyl 2,4-bis(trifluoromethyl)benzoate is a crystalline solid. Its molecular formula is C11H6F6O2, and the molecular weight is approximately 300.16 g/mol. The compound has a melting point of approximately 75-77 C. It is moderately soluble in common organic solvents such as acetone and ethyl acetate, but is poorly soluble in water. For stable storage, it should be kept in a tightly sealed container at room temperature, away from heat and direct sunlight. As a compound containing two trifluoromethyl groups and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 2,4-bis(trifluoromethyl)benzoate serves as a specialized intermediate. The two trifluoromethyl groups provide strong electron-withdrawing effects, and the ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antiviral drugs, the unique substituents of methyl 2,4-bis(trifluoromethyl)benzoate can be utilized to design drugs with enhanced antiviral activity and pharmacokinetic properties (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as noted in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 2,4-bis(trifluoromethyl)benzoate
Your Rating