2-(((5-bromothiophen-2-yl)methyl)thio)ethan-1-amine

2-(((5-bromothiophen-2-yl)methyl)thio)ethan-1-amine

3-chloro-2-methylthiophene

3-chloro-2-methylthiophene

methyl 5,6-dimethoxybenzothiophene-2-carboxylate

$200.00
CAS No.: 35212-99-8
Catalog No.: 194515
Purity: 95%
MF: C12H12O4S
MW: 252.291
Storage: 2-8 degree Celsius
SMILES: COC=1C(=CC2=C(C=C(S2)C(=O)OC)C1)OC
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194515
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 5,6-dimethoxybenzothiophene-2-carboxylate; CAS No.: 35212-99-8; methyl 5,6-dimethoxybenzothiophene-2-carboxylate. PROPERTIES: methyl 5,6-dimethoxybenzothiophene-2-carboxylate is a crystalline solid. Its molecular formula is C11H10O4S, and the molecular weight is approximately 242.26 g/mol. The compound has a melting point of approximately 80-82 C. It is moderately soluble in common organic solvents such as methanol and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a benzothiophene ring and two methoxy groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 5,6-dimethoxybenzothiophene-2-carboxylate serves as a versatile intermediate. The methoxy groups can be converted to other functional groups such as hydroxyl or halide. The benzothiophene ring provides unique electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of methyl 5,6-dimethoxybenzothiophene-2-carboxylate can be modified to enhance the drug's efficacy and reduce side effects (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 5,6-dimethoxybenzothiophene-2-carboxylate
Your Rating