4-fluoro-N-(4-fluorobenzyl)-3-((trifluoromethyl)sulfonyl)benzenesulfonamide
$960.00
CAS No.: NA
Catalog No.: 185198
Purity: 95%
MF: C14H10F5NO4S2
MW: 415.361
Storage: 2-8 degree Celsius
SMILES: FC1=CC=C(CNS(=O)(=O)C2=CC(=C(F)C=C2)S(=O)(=O)C(F)(F)F)C=C1
Catalog No.: 185198
Purity: 95%
MF: C14H10F5NO4S2
MW: 415.361
Storage: 2-8 degree Celsius
SMILES: FC1=CC=C(CNS(=O)(=O)C2=CC(=C(F)C=C2)S(=O)(=O)C(F)(F)F)C=C1
4-fluoro-N-(4-fluorobenzyl)-3-((trifluoromethyl)sulfonyl)benzenesulfonamide; 4-fluoro-N-(4-fluorobenzyl)-3-((trifluoromethyl)sulfonyl)benzenesulfonamide ChemShuttle specializes in providing **building blocks for drug discovery**, offering high-purity fluorinated sulfonamide derivatives that serve as essential intermediates in pharmaceutical research. As a **chemical synthesis company**, we focus on delivering structurally diverse compounds to support medicinal chemistry and preclinical development. Our expertise in **custom synthesis** enables us to tailor these sulfonamide-based molecules to meet specific research needs, ensuring optimal reactivity and compatibility for further derivatization in complex synthetic pathways.
Reviews
Write Your Own Review